C25H47ISiSn — CID 11828272
tributyl-[3-iodo-2,2-di(propan-2-yl)-5,6-dihydro-4H-cyclopenta[c]silol-1-yl]stannane (PubChem CID 11828272) has the molecular formula C25H47ISiSn and a molecular weight of 621.35 g/mol. Its IUPAC name is tributyl-[3-iodo-2,2-di(propan-2-yl)-5,6-dihydro-4H-cyclopenta[c]silol-1-yl]stannane.
| Compound Name | tributyl-[3-iodo-2,2-di(propan-2-yl)-5,6-dihydro-4H-cyclopenta[c]silol-1-yl]stannane |
|---|---|
| PubChem CID | 11828272 |
| Molecular Formula | C25H47ISiSn |
| Molecular Weight | 621.35 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | tributyl-[3-iodo-2,2-di(propan-2-yl)-5,6-dihydro-4H-cyclopenta[c]silol-1-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=C2CCCC2=C(I)[Si]1(C(C)C)C(C)C |
| InChI | InChI=1S/C13H20ISi.3C4H9.Sn/c1-9(2)15(10(3)4)8-11-6-5-7-12(11)13(15)14;3*1-3-4-2;/h9-10H,5-7H2,1-4H3;3*1,3-4H2,2H3; |
| InChIKey | ASLAGCYSZHZNGF-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.35 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|