C16H17N3O3 — CID 100920211
(1S,4S,7R,9R)-16-acetyl-4-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 100920211) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is (1S,4S,7R,9R)-16-acetyl-4-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (1S,4S,7R,9R)-16-acetyl-4-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 100920211 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (1S,4S,7R,9R)-16-acetyl-4-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | CC(=O)N1c2ccccc2[C@H]2C[C@@H]3C(=O)N[C@@H](C)C(=O)N3[C@H]21 |
| InChI | InChI=1S/C16H17N3O3/c1-8-16(22)19-13(14(21)17-8)7-11-10-5-3-4-6-12(10)18(9(2)20)15(11)19/h3-6,8,11,13,15H,7H2,1-2H3,(H,17,21)/t8-,11+,13+,15+/m0/s1 |
| InChIKey | LNJNBHIQUYACOZ-DGFVYPATSA-N |
| XLogP | 0.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |