C20H38OSi — CID 100920324
tert-butyl-dimethyl-[(1R,2R)-1-oct-1-ynyl-2-propan-2-ylcyclopropyl]oxysilane (PubChem CID 100920324) has the molecular formula C20H38OSi and a molecular weight of 322.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2R)-1-oct-1-ynyl-2-propan-2-ylcyclopropyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,2R)-1-oct-1-ynyl-2-propan-2-ylcyclopropyl]oxysilane |
|---|---|
| PubChem CID | 100920324 |
| Molecular Formula | C20H38OSi |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2R)-1-oct-1-ynyl-2-propan-2-ylcyclopropyl]oxysilane |
| SMILES | CCCCCCC#C[C@@]1(O[Si](C)(C)C(C)(C)C)C[C@@H]1C(C)C |
| InChI | InChI=1S/C20H38OSi/c1-9-10-11-12-13-14-15-20(16-18(20)17(2)3)21-22(7,8)19(4,5)6/h17-18H,9-13,16H2,1-8H3/t18-,20-/m1/s1 |
| InChIKey | QFKIRBPMVSZNQX-UYAOXDASSA-N |
| XLogP | 6.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|