C16H32OSi — CID 54243911
triethyl(4-ethyloct-1-yn-4-yloxy)silane (PubChem CID 54243911) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is triethyl(4-ethyloct-1-yn-4-yloxy)silane.
| Compound Name | triethyl(4-ethyloct-1-yn-4-yloxy)silane |
|---|---|
| PubChem CID | 54243911 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | triethyl(4-ethyloct-1-yn-4-yloxy)silane |
| SMILES | C#CCC(CC)(CCCC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H32OSi/c1-7-13-15-16(9-3,14-8-2)17-18(10-4,11-5)12-6/h2H,7,9-15H2,1,3-6H3 |
| InChIKey | QRXINCVUVHSLNS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|