C26H48O2Si2 — CID 139055165
tert-butyl-[(1R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,10-dimethylcyclododeca-2,8-diyn-1-yl]oxy-dimethylsilane (PubChem CID 139055165) has the molecular formula C26H48O2Si2 and a molecular weight of 448.84 g/mol. Its IUPAC name is tert-butyl-[(1R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,10-dimethylcyclododeca-2,8-diyn-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,10-dimethylcyclododeca-2,8-diyn-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 139055165 |
| Molecular Formula | C26H48O2Si2 |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | tert-butyl-[(1R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,10-dimethylcyclododeca-2,8-diyn-1-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]1(C)C#CCCCCC#C[C@](C)(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C26H48O2Si2/c1-23(2,3)29(9,10)27-25(7)19-17-15-13-14-16-18-20-26(8,22-21-25)28-30(11,12)24(4,5)6/h13-16,21-22H2,1-12H3/t25-,26-/m0/s1 |
| InChIKey | JCPKRHOZRBQLEB-UIOOFZCWSA-N |
| XLogP | 7.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|