C28H52O2Si2 — CID 102069976
tert-butyl-[12-[tert-butyl(dimethyl)silyl]oxy-1,12-dimethylcyclotetradeca-3,9-diyn-1-yl]oxy-dimethylsilane (PubChem CID 102069976) has the molecular formula C28H52O2Si2 and a molecular weight of 476.89 g/mol. Its IUPAC name is tert-butyl-[12-[tert-butyl(dimethyl)silyl]oxy-1,12-dimethylcyclotetradeca-3,9-diyn-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[12-[tert-butyl(dimethyl)silyl]oxy-1,12-dimethylcyclotetradeca-3,9-diyn-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102069976 |
| Molecular Formula | C28H52O2Si2 |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.35 |
| IUPAC Name | tert-butyl-[12-[tert-butyl(dimethyl)silyl]oxy-1,12-dimethylcyclotetradeca-3,9-diyn-1-yl]oxy-dimethylsilane |
| SMILES | CC1(O[Si](C)(C)C(C)(C)C)CC#CCCCCC#CCC(C)(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C28H52O2Si2/c1-25(2,3)31(9,10)29-27(7)21-19-17-15-13-14-16-18-20-22-28(8,24-23-27)30-32(11,12)26(4,5)6/h13-16,21-24H2,1-12H3 |
| InChIKey | IFJZDHCKQCWSHX-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|