C27H50O2Si2 — CID 102069974
tert-butyl-[11-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethylcyclotrideca-2,9-diyn-1-yl]oxy-dimethylsilane (PubChem CID 102069974) has the molecular formula C27H50O2Si2 and a molecular weight of 462.87 g/mol. Its IUPAC name is tert-butyl-[11-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethylcyclotrideca-2,9-diyn-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[11-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethylcyclotrideca-2,9-diyn-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102069974 |
| Molecular Formula | C27H50O2Si2 |
| Molecular Weight | 462.87 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | tert-butyl-[11-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethylcyclotrideca-2,9-diyn-1-yl]oxy-dimethylsilane |
| SMILES | CC1(O[Si](C)(C)C(C)(C)C)C#CCCCCCC#CC(C)(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C27H50O2Si2/c1-24(2,3)30(9,10)28-26(7)20-18-16-14-13-15-17-19-21-27(8,23-22-26)29-31(11,12)25(4,5)6/h13-17,22-23H2,1-12H3 |
| InChIKey | IJLYCOSBYBPGOE-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.87 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|