C19H40O2Si3 — CID 20565068
4-(2-trimethylsilylethynyl)oct-1-yn-4-ol;trimethyl(trimethylsilyloxy)silane (PubChem CID 20565068) has the molecular formula C19H40O2Si3 and a molecular weight of 384.79 g/mol. Its IUPAC name is 4-(2-trimethylsilylethynyl)oct-1-yn-4-ol;trimethyl(trimethylsilyloxy)silane.
| Compound Name | 4-(2-trimethylsilylethynyl)oct-1-yn-4-ol;trimethyl(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 20565068 |
| Molecular Formula | C19H40O2Si3 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 4-(2-trimethylsilylethynyl)oct-1-yn-4-ol;trimethyl(trimethylsilyloxy)silane |
| SMILES | C#CCC(O)(C#C[Si](C)(C)C)CCCC.C[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H22OSi.C6H18OSi2/c1-6-8-10-13(14,9-7-2)11-12-15(3,4)5;1-8(2,3)7-9(4,5)6/h2,14H,6,8-10H2,1,3-5H3;1-6H3 |
| InChIKey | OJTMTKSJLQVHQF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|