C15H32OSi2 — CID 166442138
3-ethyl-5,7-bis(trimethylsilyl)hept-6-yn-3-ol (PubChem CID 166442138) has the molecular formula C15H32OSi2 and a molecular weight of 284.59 g/mol. Its IUPAC name is 3-ethyl-5,7-bis(trimethylsilyl)hept-6-yn-3-ol.
| Compound Name | 3-ethyl-5,7-bis(trimethylsilyl)hept-6-yn-3-ol |
|---|---|
| PubChem CID | 166442138 |
| Molecular Formula | C15H32OSi2 |
| Molecular Weight | 284.59 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 3-ethyl-5,7-bis(trimethylsilyl)hept-6-yn-3-ol |
| SMILES | CCC(O)(CC)CC(C#C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C15H32OSi2/c1-9-15(16,10-2)13-14(18(6,7)8)11-12-17(3,4)5/h14,16H,9-10,13H2,1-8H3 |
| InChIKey | TZWFOGKGWSIUJS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|