C15H38OSi3 — CID 18684361
2-methyl-5,5,5-tris(trimethylsilyl)pentan-2-ol (PubChem CID 18684361) has the molecular formula C15H38OSi3 and a molecular weight of 318.73 g/mol. Its IUPAC name is 2-methyl-5,5,5-tris(trimethylsilyl)pentan-2-ol.
| Compound Name | 2-methyl-5,5,5-tris(trimethylsilyl)pentan-2-ol |
|---|---|
| PubChem CID | 18684361 |
| Molecular Formula | C15H38OSi3 |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-methyl-5,5,5-tris(trimethylsilyl)pentan-2-ol |
| SMILES | CC(C)(O)CCC([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C15H38OSi3/c1-14(2,16)12-13-15(17(3,4)5,18(6,7)8)19(9,10)11/h16H,12-13H2,1-11H3 |
| InChIKey | JGJGLHCFKWRKAN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|