C13H30OSi — CID 123364705
4-[tert-butyl(dimethyl)silyl]-2,4-dimethylpentan-2-ol (PubChem CID 123364705) has the molecular formula C13H30OSi and a molecular weight of 230.47 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]-2,4-dimethylpentan-2-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 123364705 |
| Molecular Formula | C13H30OSi |
| Molecular Weight | 230.47 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)(O)CC(C)(C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H30OSi/c1-11(2,3)15(8,9)13(6,7)10-12(4,5)14/h14H,10H2,1-9H3 |
| InChIKey | ZXOXRVYFMKEOBY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|