C15H30OSi2 — CID 166438594
1-[2,4-bis(trimethylsilyl)but-3-ynyl]cyclopentan-1-ol (PubChem CID 166438594) has the molecular formula C15H30OSi2 and a molecular weight of 282.58 g/mol. Its IUPAC name is 1-[2,4-bis(trimethylsilyl)but-3-ynyl]cyclopentan-1-ol.
| Compound Name | 1-[2,4-bis(trimethylsilyl)but-3-ynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 166438594 |
| Molecular Formula | C15H30OSi2 |
| Molecular Weight | 282.58 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-[2,4-bis(trimethylsilyl)but-3-ynyl]cyclopentan-1-ol |
| SMILES | C[Si](C)(C)C#CC(CC1(O)CCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C15H30OSi2/c1-17(2,3)12-9-14(18(4,5)6)13-15(16)10-7-8-11-15/h14,16H,7-8,10-11,13H2,1-6H3 |
| InChIKey | YWMIKDFNNHDFCX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|