C25H46O2Si2 — CID 102069979
tert-butyl-[11-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethylcycloundeca-2,9-diyn-1-yl]oxy-dimethylsilane (PubChem CID 102069979) has the molecular formula C25H46O2Si2 and a molecular weight of 434.81 g/mol. Its IUPAC name is tert-butyl-[11-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethylcycloundeca-2,9-diyn-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[11-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethylcycloundeca-2,9-diyn-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102069979 |
| Molecular Formula | C25H46O2Si2 |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | tert-butyl-[11-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethylcycloundeca-2,9-diyn-1-yl]oxy-dimethylsilane |
| SMILES | CC1(O[Si](C)(C)C(C)(C)C)C#CCCCCCC#CC1(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O2Si2/c1-22(2,3)28(9,10)26-24(7)20-18-16-14-13-15-17-19-21-25(24,8)27-29(11,12)23(4,5)6/h13-17H2,1-12H3 |
| InChIKey | OPAHXWXMLJECNC-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|