C20H38O2Si2 — CID 10959526
tert-butyl-[4-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylhexa-1,5-diyn-3-yl]oxy-dimethylsilane (PubChem CID 10959526) has the molecular formula C20H38O2Si2 and a molecular weight of 366.69 g/mol. Its IUPAC name is tert-butyl-[4-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylhexa-1,5-diyn-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[4-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylhexa-1,5-diyn-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10959526 |
| Molecular Formula | C20H38O2Si2 |
| Molecular Weight | 366.69 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | tert-butyl-[4-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylhexa-1,5-diyn-3-yl]oxy-dimethylsilane |
| SMILES | C#CC(C)(O[Si](C)(C)C(C)(C)C)C(C)(C#C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O2Si2/c1-15-19(9,21-23(11,12)17(3,4)5)20(10,16-2)22-24(13,14)18(6,7)8/h1-2H,3-14H3 |
| InChIKey | OGZWZQPYRRLXJU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|