C14H32O2Si3 — CID 87600761
dimethyl-(3-methyl-3-trimethylsilyloxypent-4-ynyl)-trimethylsilyloxysilane (PubChem CID 87600761) has the molecular formula C14H32O2Si3 and a molecular weight of 316.67 g/mol. Its IUPAC name is dimethyl-(3-methyl-3-trimethylsilyloxypent-4-ynyl)-trimethylsilyloxysilane.
| Compound Name | dimethyl-(3-methyl-3-trimethylsilyloxypent-4-ynyl)-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 87600761 |
| Molecular Formula | C14H32O2Si3 |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | dimethyl-(3-methyl-3-trimethylsilyloxypent-4-ynyl)-trimethylsilyloxysilane |
| SMILES | C#CC(C)(CC[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H32O2Si3/c1-11-14(2,15-17(3,4)5)12-13-19(9,10)16-18(6,7)8/h1H,12-13H2,2-10H3 |
| InChIKey | JTJVFIZUBGBJAZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|