C15H28OSi2 — CID 139249385
tert-butyl-dimethyl-(3-methyl-1-trimethylsilylpenta-1,4-diyn-3-yl)oxysilane (PubChem CID 139249385) has the molecular formula C15H28OSi2 and a molecular weight of 280.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-(3-methyl-1-trimethylsilylpenta-1,4-diyn-3-yl)oxysilane.
| Compound Name | tert-butyl-dimethyl-(3-methyl-1-trimethylsilylpenta-1,4-diyn-3-yl)oxysilane |
|---|---|
| PubChem CID | 139249385 |
| Molecular Formula | C15H28OSi2 |
| Molecular Weight | 280.56 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | tert-butyl-dimethyl-(3-methyl-1-trimethylsilylpenta-1,4-diyn-3-yl)oxysilane |
| SMILES | C#CC(C)(C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28OSi2/c1-11-15(5,12-13-17(6,7)8)16-18(9,10)14(2,3)4/h1H,2-10H3 |
| InChIKey | QWYUFMXZMFLMTG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|