C12H22OSi2 — CID 139249384
trimethyl-(3-methyl-3-trimethylsilyloxypenta-1,4-diynyl)silane (PubChem CID 139249384) has the molecular formula C12H22OSi2 and a molecular weight of 238.48 g/mol. Its IUPAC name is trimethyl-(3-methyl-3-trimethylsilyloxypenta-1,4-diynyl)silane.
| Compound Name | trimethyl-(3-methyl-3-trimethylsilyloxypenta-1,4-diynyl)silane |
|---|---|
| PubChem CID | 139249384 |
| Molecular Formula | C12H22OSi2 |
| Molecular Weight | 238.48 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | trimethyl-(3-methyl-3-trimethylsilyloxypenta-1,4-diynyl)silane |
| SMILES | C#CC(C)(C#C[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H22OSi2/c1-9-12(2,13-15(6,7)8)10-11-14(3,4)5/h1H,2-8H3 |
| InChIKey | KCKSTYREVOEKHV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|