C26H38O2Si2 — CID 102086370
(3,6-diethynyl-3,6-dimethoxy-8-triethylsilylocta-1,4,7-triynyl)-triethylsilane (PubChem CID 102086370) has the molecular formula C26H38O2Si2 and a molecular weight of 438.76 g/mol. Its IUPAC name is (3,6-diethynyl-3,6-dimethoxy-8-triethylsilylocta-1,4,7-triynyl)-triethylsilane.
| Compound Name | (3,6-diethynyl-3,6-dimethoxy-8-triethylsilylocta-1,4,7-triynyl)-triethylsilane |
|---|---|
| PubChem CID | 102086370 |
| Molecular Formula | C26H38O2Si2 |
| Molecular Weight | 438.76 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (3,6-diethynyl-3,6-dimethoxy-8-triethylsilylocta-1,4,7-triynyl)-triethylsilane |
| SMILES | C#CC(C#CC(C#C)(C#C[Si](CC)(CC)CC)OC)(C#C[Si](CC)(CC)CC)OC |
| InChI | InChI=1S/C26H38O2Si2/c1-11-25(27-9,21-23-29(13-3,14-4)15-5)19-20-26(12-2,28-10)22-24-30(16-6,17-7)18-8/h1-2H,13-18H2,3-10H3 |
| InChIKey | LPBGTZSOZBZGJA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.76 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|