C19H32OSi2 — CID 135086314
(3R)-3-ethynyl-1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol (PubChem CID 135086314) has the molecular formula C19H32OSi2 and a molecular weight of 332.64 g/mol. Its IUPAC name is (3R)-3-ethynyl-1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol.
| Compound Name | (3R)-3-ethynyl-1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 135086314 |
| Molecular Formula | C19H32OSi2 |
| Molecular Weight | 332.64 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (3R)-3-ethynyl-1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol |
| SMILES | C#C[C@@](O)(C#C[Si](C)(C)C)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H32OSi2/c1-11-19(20,12-14-21(8,9)10)13-15-22(16(2)3,17(4)5)18(6)7/h1,16-18,20H,2-10H3/t19-/m1/s1 |
| InChIKey | ILIONAPWHBHGBD-LJQANCHMSA-N |
| XLogP | 4.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|