C10H16OSi — CID 10678951
2-methyl-6-trimethylsilylhexa-3,5-diyn-2-ol (PubChem CID 10678951) has the molecular formula C10H16OSi and a molecular weight of 180.32 g/mol. Its IUPAC name is 2-methyl-6-trimethylsilylhexa-3,5-diyn-2-ol.
| Compound Name | 2-methyl-6-trimethylsilylhexa-3,5-diyn-2-ol |
|---|---|
| PubChem CID | 10678951 |
| Molecular Formula | C10H16OSi |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-methyl-6-trimethylsilylhexa-3,5-diyn-2-ol |
| SMILES | CC(C)(O)C#CC#C[Si](C)(C)C |
| InChI | InChI=1S/C10H16OSi/c1-10(2,11)8-6-7-9-12(3,4)5/h11H,1-5H3 |
| InChIKey | NCPIEYUZNMOEIQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|