C36H64OSi3 — CID 15258550
1,7-bis[tri(propan-2-yl)silyl]-3-[2-tri(propan-2-yl)silylethynyl]hepta-1,4,6-triyn-3-ol (PubChem CID 15258550) has the molecular formula C36H64OSi3 and a molecular weight of 597.17 g/mol. Its IUPAC name is 1,7-bis[tri(propan-2-yl)silyl]-3-[2-tri(propan-2-yl)silylethynyl]hepta-1,4,6-triyn-3-ol.
| Compound Name | 1,7-bis[tri(propan-2-yl)silyl]-3-[2-tri(propan-2-yl)silylethynyl]hepta-1,4,6-triyn-3-ol |
|---|---|
| PubChem CID | 15258550 |
| Molecular Formula | C36H64OSi3 |
| Molecular Weight | 597.17 g/mol |
| Exact Mass | 596.43 |
| IUPAC Name | 1,7-bis[tri(propan-2-yl)silyl]-3-[2-tri(propan-2-yl)silylethynyl]hepta-1,4,6-triyn-3-ol |
| SMILES | CC(C)[Si](C#CC#CC(O)(C#C[Si](C(C)C)(C(C)C)C(C)C)C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H64OSi3/c1-27(2)38(28(3)4,29(5)6)24-20-19-21-36(37,22-25-39(30(7)8,31(9)10)32(11)12)23-26-40(33(13)14,34(15)16)35(17)18/h27-35,37H,1-18H3 |
| InChIKey | JYYJKOMNAZZABD-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.17 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|