C16H32OSi3 — CID 166442571
(3S)-3-[dimethyl(3-trimethylsilylprop-2-ynyl)silyl]-1-trimethylsilylpent-1-yn-3-ol (PubChem CID 166442571) has the molecular formula C16H32OSi3 and a molecular weight of 324.69 g/mol. Its IUPAC name is (3S)-3-[dimethyl(3-trimethylsilylprop-2-ynyl)silyl]-1-trimethylsilylpent-1-yn-3-ol.
| Compound Name | (3S)-3-[dimethyl(3-trimethylsilylprop-2-ynyl)silyl]-1-trimethylsilylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 166442571 |
| Molecular Formula | C16H32OSi3 |
| Molecular Weight | 324.69 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (3S)-3-[dimethyl(3-trimethylsilylprop-2-ynyl)silyl]-1-trimethylsilylpent-1-yn-3-ol |
| SMILES | CC[C@@](O)(C#C[Si](C)(C)C)[Si](C)(C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C16H32OSi3/c1-10-16(17,12-15-19(5,6)7)20(8,9)14-11-13-18(2,3)4/h17H,10,14H2,1-9H3/t16-/m0/s1 |
| InChIKey | VNWCLFBYOLKHCV-INIZCTEOSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|