C10H22OSi2 — CID 15121706
2,4-bis(trimethylsilyl)but-3-yn-2-ol (PubChem CID 15121706) has the molecular formula C10H22OSi2 and a molecular weight of 214.46 g/mol. Its IUPAC name is 2,4-bis(trimethylsilyl)but-3-yn-2-ol.
| Compound Name | 2,4-bis(trimethylsilyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 15121706 |
| Molecular Formula | C10H22OSi2 |
| Molecular Weight | 214.46 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2,4-bis(trimethylsilyl)but-3-yn-2-ol |
| SMILES | CC(O)(C#C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C10H22OSi2/c1-10(11,13(5,6)7)8-9-12(2,3)4/h11H,1-7H3 |
| InChIKey | KZGUZSQDTZFEFS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|