C25H46OSi3 — CID 12036884
1-triethylsilyl-3-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol (PubChem CID 12036884) has the molecular formula C25H46OSi3 and a molecular weight of 446.90 g/mol. Its IUPAC name is 1-triethylsilyl-3-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol.
| Compound Name | 1-triethylsilyl-3-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 12036884 |
| Molecular Formula | C25H46OSi3 |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 1-triethylsilyl-3-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol |
| SMILES | CC[Si](C#CC(O)(C#C[Si](C)(C)C)C#C[Si](C(C)C)(C(C)C)C(C)C)(CC)CC |
| InChI | InChI=1S/C25H46OSi3/c1-13-28(14-2,15-3)20-17-25(26,16-19-27(10,11)12)18-21-29(22(4)5,23(6)7)24(8)9/h22-24,26H,13-15H2,1-12H3 |
| InChIKey | ALJDBKWFHRWERB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|