C70H104O6Si6 — CID 138971021
4,7,13,16-tetramethoxy-1,4,7,10,13,16-hexakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayne-1,10-diol (PubChem CID 138971021) has the molecular formula C70H104O6Si6 and a molecular weight of 1210.11 g/mol. Its IUPAC name is 4,7,13,16-tetramethoxy-1,4,7,10,13,16-hexakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayne-1,10-diol.
| Compound Name | 4,7,13,16-tetramethoxy-1,4,7,10,13,16-hexakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayne-1,10-diol |
|---|---|
| PubChem CID | 138971021 |
| Molecular Formula | C70H104O6Si6 |
| Molecular Weight | 1210.11 g/mol |
| Exact Mass | 1208.64 |
| IUPAC Name | 4,7,13,16-tetramethoxy-1,4,7,10,13,16-hexakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayne-1,10-diol |
| SMILES | CC[Si](C#CC1(O)C#CC(C#C[Si](CC)(CC)CC)(OC)C#CC(C#C[Si](CC)(CC)CC)(OC)C#CC(O)(C#C[Si](CC)(CC)CC)C#CC(C#C[Si](CC)(CC)CC)(OC)C#CC(C#C[Si](CC)(CC)CC)(OC)C#C1)(CC)CC |
| InChI | InChI=1S/C70H104O6Si6/c1-23-77(24-2,25-3)59-53-65(71)41-45-67(73-19,55-61-79(29-7,30-8)31-9)49-51-69(75-21,57-63-81(35-13,36-14)37-15)47-43-66(72,54-60-78(26-4,27-5)28-6)44-48-70(76-22,58-64-82(38-16,39-17)40-18)52-50-68(74-20,46-42-65)56-62-80(32-10,33-11)34-12/h71-72H,23-40H2,1-22H3 |
| InChIKey | FRVOOPFBLUXSIR-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1210.11 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|