C46H78O2Si4 — CID 12036887
[3,8-dimethoxy-3,8-bis(2-triethylsilylethynyl)-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane (PubChem CID 12036887) has the molecular formula C46H78O2Si4 and a molecular weight of 775.47 g/mol. Its IUPAC name is [3,8-dimethoxy-3,8-bis(2-triethylsilylethynyl)-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane.
| Compound Name | [3,8-dimethoxy-3,8-bis(2-triethylsilylethynyl)-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 12036887 |
| Molecular Formula | C46H78O2Si4 |
| Molecular Weight | 775.47 g/mol |
| Exact Mass | 774.51 |
| IUPAC Name | [3,8-dimethoxy-3,8-bis(2-triethylsilylethynyl)-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane |
| SMILES | CC[Si](C#CC(C#CC#CC(C#C[Si](CC)(CC)CC)(C#C[Si](C(C)C)(C(C)C)C(C)C)OC)(C#C[Si](C(C)C)(C(C)C)C(C)C)OC)(CC)CC |
| InChI | InChI=1S/C46H78O2Si4/c1-21-49(22-2,23-3)35-31-45(47-19,33-37-51(39(7)8,40(9)10)41(11)12)29-27-28-30-46(48-20,32-36-50(24-4,25-5)26-6)34-38-52(42(13)14,43(15)16)44(17)18/h39-44H,21-26H2,1-20H3 |
| InChIKey | DBJVEBSBHZRUJX-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.47 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|