C20H42O2Si2 — CID 154711483
(2-tert-butylperoxy-4-triethylsilylbut-3-ynyl)-triethylsilane (PubChem CID 154711483) has the molecular formula C20H42O2Si2 and a molecular weight of 370.73 g/mol. Its IUPAC name is (2-tert-butylperoxy-4-triethylsilylbut-3-ynyl)-triethylsilane.
| Compound Name | (2-tert-butylperoxy-4-triethylsilylbut-3-ynyl)-triethylsilane |
|---|---|
| PubChem CID | 154711483 |
| Molecular Formula | C20H42O2Si2 |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (2-tert-butylperoxy-4-triethylsilylbut-3-ynyl)-triethylsilane |
| SMILES | CC[Si](C#CC(C[Si](CC)(CC)CC)OOC(C)(C)C)(CC)CC |
| InChI | InChI=1S/C20H42O2Si2/c1-10-23(11-2,12-3)17-16-19(21-22-20(7,8)9)18-24(13-4,14-5)15-6/h19H,10-15,18H2,1-9H3 |
| InChIKey | NLXBZOIBFGQFEZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|