C22H40O2Si2 — CID 12027346
tert-butyl-dimethyl-[3-[2-[2-tri(propan-2-yl)silylethynyl]oxiran-2-yl]prop-2-ynoxy]silane (PubChem CID 12027346) has the molecular formula C22H40O2Si2 and a molecular weight of 392.73 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-[2-[2-tri(propan-2-yl)silylethynyl]oxiran-2-yl]prop-2-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[3-[2-[2-tri(propan-2-yl)silylethynyl]oxiran-2-yl]prop-2-ynoxy]silane |
|---|---|
| PubChem CID | 12027346 |
| Molecular Formula | C22H40O2Si2 |
| Molecular Weight | 392.73 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | tert-butyl-dimethyl-[3-[2-[2-tri(propan-2-yl)silylethynyl]oxiran-2-yl]prop-2-ynoxy]silane |
| SMILES | CC(C)[Si](C#CC1(C#CCO[Si](C)(C)C(C)(C)C)CO1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H40O2Si2/c1-18(2)26(19(3)4,20(5)6)16-14-22(17-23-22)13-12-15-24-25(10,11)21(7,8)9/h18-20H,15,17H2,1-11H3 |
| InChIKey | HKGFXGVOCDRLDN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.73 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|