C16H34O2Si3 — CID 10545283
trimethyl-[2-trimethylsilyloxy-4-(1-trimethylsilyloxycyclopropyl)but-3-yn-2-yl]silane (PubChem CID 10545283) has the molecular formula C16H34O2Si3 and a molecular weight of 342.70 g/mol. Its IUPAC name is trimethyl-[2-trimethylsilyloxy-4-(1-trimethylsilyloxycyclopropyl)but-3-yn-2-yl]silane.
| Compound Name | trimethyl-[2-trimethylsilyloxy-4-(1-trimethylsilyloxycyclopropyl)but-3-yn-2-yl]silane |
|---|---|
| PubChem CID | 10545283 |
| Molecular Formula | C16H34O2Si3 |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | trimethyl-[2-trimethylsilyloxy-4-(1-trimethylsilyloxycyclopropyl)but-3-yn-2-yl]silane |
| SMILES | CC(C#CC1(O[Si](C)(C)C)CC1)(O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H34O2Si3/c1-15(19(2,3)4,17-20(5,6)7)11-12-16(13-14-16)18-21(8,9)10/h13-14H2,1-10H3 |
| InChIKey | CXQVJHDOANPJQO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|