C20H44O2Si3 — CID 144689663
4,4-bis[[dimethyl(2-methylpropyl)silyl]oxy]pent-1-ynyl-trimethylsilane (PubChem CID 144689663) has the molecular formula C20H44O2Si3 and a molecular weight of 400.83 g/mol. Its IUPAC name is 4,4-bis[[dimethyl(2-methylpropyl)silyl]oxy]pent-1-ynyl-trimethylsilane.
| Compound Name | 4,4-bis[[dimethyl(2-methylpropyl)silyl]oxy]pent-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 144689663 |
| Molecular Formula | C20H44O2Si3 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 4,4-bis[[dimethyl(2-methylpropyl)silyl]oxy]pent-1-ynyl-trimethylsilane |
| SMILES | CC(C)C[Si](C)(C)OC(C)(CC#C[Si](C)(C)C)O[Si](C)(C)CC(C)C |
| InChI | InChI=1S/C20H44O2Si3/c1-18(2)16-24(9,10)21-20(5,14-13-15-23(6,7)8)22-25(11,12)17-19(3)4/h18-19H,14,16-17H2,1-12H3 |
| InChIKey | SURYSPODSOVRNA-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|