C30H54O2Si2 — CID 101034705
[2,9-dimethyl-9-tri(propan-2-yl)silyloxydeca-3,5,7-triyn-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 101034705) has the molecular formula C30H54O2Si2 and a molecular weight of 502.93 g/mol. Its IUPAC name is [2,9-dimethyl-9-tri(propan-2-yl)silyloxydeca-3,5,7-triyn-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [2,9-dimethyl-9-tri(propan-2-yl)silyloxydeca-3,5,7-triyn-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101034705 |
| Molecular Formula | C30H54O2Si2 |
| Molecular Weight | 502.93 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | [2,9-dimethyl-9-tri(propan-2-yl)silyloxydeca-3,5,7-triyn-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC(C)(C)C#CC#CC#CC(C)(C)O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H54O2Si2/c1-23(2)33(24(3)4,25(5)6)31-29(13,14)21-19-17-18-20-22-30(15,16)32-34(26(7)8,27(9)10)28(11)12/h23-28H,1-16H3 |
| InChIKey | RKPDETWYMHYPPD-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.93 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|