C20H36O4Si2 — CID 5251012
2,2,4,4,7,7,9,9,11,11,14,14-dodecamethyl-1,3,8,10-tetraoxa-2,9-disilacyclotetradeca-5,12-diyne (PubChem CID 5251012) has the molecular formula C20H36O4Si2 and a molecular weight of 396.68 g/mol. Its IUPAC name is 2,2,4,4,7,7,9,9,11,11,14,14-dodecamethyl-1,3,8,10-tetraoxa-2,9-disilacyclotetradeca-5,12-diyne.
| Compound Name | 2,2,4,4,7,7,9,9,11,11,14,14-dodecamethyl-1,3,8,10-tetraoxa-2,9-disilacyclotetradeca-5,12-diyne |
|---|---|
| PubChem CID | 5251012 |
| Molecular Formula | C20H36O4Si2 |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2,2,4,4,7,7,9,9,11,11,14,14-dodecamethyl-1,3,8,10-tetraoxa-2,9-disilacyclotetradeca-5,12-diyne |
| SMILES | CC1(C)C#CC(C)(C)O[Si](C)(C)OC(C)(C)C#CC(C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C20H36O4Si2/c1-17(2)13-14-18(3,4)23-26(11,12)24-20(7,8)16-15-19(5,6)22-25(9,10)21-17/h1-12H3 |
| InChIKey | QBCUOGHRERVTNA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|