C22H48O2Si2Sn — CID 15271676
trimethyl-[2-methyl-5-trimethylsilyloxy-5-tri(propan-2-yl)stannylhex-3-yn-2-yl]oxysilane (PubChem CID 15271676) has the molecular formula C22H48O2Si2Sn and a molecular weight of 519.51 g/mol. Its IUPAC name is trimethyl-[2-methyl-5-trimethylsilyloxy-5-tri(propan-2-yl)stannylhex-3-yn-2-yl]oxysilane.
| Compound Name | trimethyl-[2-methyl-5-trimethylsilyloxy-5-tri(propan-2-yl)stannylhex-3-yn-2-yl]oxysilane |
|---|---|
| PubChem CID | 15271676 |
| Molecular Formula | C22H48O2Si2Sn |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | trimethyl-[2-methyl-5-trimethylsilyloxy-5-tri(propan-2-yl)stannylhex-3-yn-2-yl]oxysilane |
| SMILES | CC(C)[Sn](C(C)C)(C(C)C)C(C)(C#CC(C)(C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H27O2Si2.3C3H7.Sn/c1-12(14-16(4,5)6)10-11-13(2,3)15-17(7,8)9;3*1-3-2;/h1-9H3;3*3H,1-2H3; |
| InChIKey | SAOSYIZJAOAZGE-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|