C34H50O2Si2 — CID 134885025
[(3R)-3,8-diethynyl-3,8-dimethoxy-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane (PubChem CID 134885025) has the molecular formula C34H50O2Si2 and a molecular weight of 546.94 g/mol. Its IUPAC name is [(3R)-3,8-diethynyl-3,8-dimethoxy-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane.
| Compound Name | [(3R)-3,8-diethynyl-3,8-dimethoxy-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134885025 |
| Molecular Formula | C34H50O2Si2 |
| Molecular Weight | 546.94 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | [(3R)-3,8-diethynyl-3,8-dimethoxy-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane |
| SMILES | C#CC(C#CC#C[C@](C#C)(C#C[Si](C(C)C)(C(C)C)C(C)C)OC)(C#C[Si](C(C)C)(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C34H50O2Si2/c1-17-33(35-15,23-25-37(27(3)4,28(5)6)29(7)8)21-19-20-22-34(18-2,36-16)24-26-38(30(9)10,31(11)12)32(13)14/h1-2,27-32H,3-16H3/t33-,34?/m1/s1 |
| InChIKey | LSVBPQLGSUEWPB-BONSOQDYSA-N |
| XLogP | 7.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.94 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|