C23H40OSi2 — CID 12036886
triethyl-[3-ethynyl-3-methoxy-5-tri(propan-2-yl)silylpenta-1,4-diynyl]silane (PubChem CID 12036886) has the molecular formula C23H40OSi2 and a molecular weight of 388.74 g/mol. Its IUPAC name is triethyl-[3-ethynyl-3-methoxy-5-tri(propan-2-yl)silylpenta-1,4-diynyl]silane.
| Compound Name | triethyl-[3-ethynyl-3-methoxy-5-tri(propan-2-yl)silylpenta-1,4-diynyl]silane |
|---|---|
| PubChem CID | 12036886 |
| Molecular Formula | C23H40OSi2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | triethyl-[3-ethynyl-3-methoxy-5-tri(propan-2-yl)silylpenta-1,4-diynyl]silane |
| SMILES | C#CC(C#C[Si](CC)(CC)CC)(C#C[Si](C(C)C)(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C23H40OSi2/c1-12-23(24-11,16-18-25(13-2,14-3)15-4)17-19-26(20(5)6,21(7)8)22(9)10/h1,20-22H,13-15H2,2-11H3 |
| InChIKey | UBHCGOGBLSURDG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|