C17H28OSi2 — CID 11601922
triethyl-[(3R)-3-ethynyl-3-methoxy-5-trimethylsilylpenta-1,4-diynyl]silane (PubChem CID 11601922) has the molecular formula C17H28OSi2 and a molecular weight of 304.58 g/mol. Its IUPAC name is triethyl-[(3R)-3-ethynyl-3-methoxy-5-trimethylsilylpenta-1,4-diynyl]silane.
| Compound Name | triethyl-[(3R)-3-ethynyl-3-methoxy-5-trimethylsilylpenta-1,4-diynyl]silane |
|---|---|
| PubChem CID | 11601922 |
| Molecular Formula | C17H28OSi2 |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | triethyl-[(3R)-3-ethynyl-3-methoxy-5-trimethylsilylpenta-1,4-diynyl]silane |
| SMILES | C#C[C@@](C#C[Si](C)(C)C)(C#C[Si](CC)(CC)CC)OC |
| InChI | InChI=1S/C17H28OSi2/c1-9-17(18-5,13-15-19(6,7)8)14-16-20(10-2,11-3)12-4/h1H,10-12H2,2-8H3/t17-/m1/s1 |
| InChIKey | WTYVLVUPYHKTCS-QGZVFWFLSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|