C44H66O4Si4 — CID 102086374
6,9-dimethoxy-1,14-bis(triethylsilyl)-6,9-bis(2-triethylsilylethynyl)tetradeca-1,4,7,10,13-pentayne-3,12-dione (PubChem CID 102086374) has the molecular formula C44H66O4Si4 and a molecular weight of 771.35 g/mol. Its IUPAC name is 6,9-dimethoxy-1,14-bis(triethylsilyl)-6,9-bis(2-triethylsilylethynyl)tetradeca-1,4,7,10,13-pentayne-3,12-dione.
| Compound Name | 6,9-dimethoxy-1,14-bis(triethylsilyl)-6,9-bis(2-triethylsilylethynyl)tetradeca-1,4,7,10,13-pentayne-3,12-dione |
|---|---|
| PubChem CID | 102086374 |
| Molecular Formula | C44H66O4Si4 |
| Molecular Weight | 771.35 g/mol |
| Exact Mass | 770.40 |
| IUPAC Name | 6,9-dimethoxy-1,14-bis(triethylsilyl)-6,9-bis(2-triethylsilylethynyl)tetradeca-1,4,7,10,13-pentayne-3,12-dione |
| SMILES | CC[Si](C#CC(=O)C#CC(C#CC(C#CC(=O)C#C[Si](CC)(CC)CC)(C#C[Si](CC)(CC)CC)OC)(C#C[Si](CC)(CC)CC)OC)(CC)CC |
| InChI | InChI=1S/C44H66O4Si4/c1-15-49(16-2,17-3)37-29-41(45)27-31-43(47-13,35-39-51(21-7,22-8)23-9)33-34-44(48-14,36-40-52(24-10,25-11)26-12)32-28-42(46)30-38-50(18-4,19-5)20-6/h15-26H2,1-14H3 |
| InChIKey | QLRXEGNWYIXWDW-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.35 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|