C72H108O6Si6 — CID 102086365
triethyl-[2-[1,4,7,10,13,16-hexamethoxy-4,7,10,13,16-pentakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayn-1-yl]ethynyl]silane (PubChem CID 102086365) has the molecular formula C72H108O6Si6 and a molecular weight of 1238.17 g/mol. Its IUPAC name is triethyl-[2-[1,4,7,10,13,16-hexamethoxy-4,7,10,13,16-pentakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayn-1-yl]ethynyl]silane.
| Compound Name | triethyl-[2-[1,4,7,10,13,16-hexamethoxy-4,7,10,13,16-pentakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayn-1-yl]ethynyl]silane |
|---|---|
| PubChem CID | 102086365 |
| Molecular Formula | C72H108O6Si6 |
| Molecular Weight | 1238.17 g/mol |
| Exact Mass | 1236.68 |
| IUPAC Name | triethyl-[2-[1,4,7,10,13,16-hexamethoxy-4,7,10,13,16-pentakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayn-1-yl]ethynyl]silane |
| SMILES | CC[Si](C#CC1(OC)C#CC(C#C[Si](CC)(CC)CC)(OC)C#CC(C#C[Si](CC)(CC)CC)(OC)C#CC(C#C[Si](CC)(CC)CC)(OC)C#CC(C#C[Si](CC)(CC)CC)(OC)C#CC(C#C[Si](CC)(CC)CC)(OC)C#C1)(CC)CC |
| InChI | InChI=1S/C72H108O6Si6/c1-25-79(26-2,27-3)61-55-67(73-19)43-45-68(74-20,56-62-80(28-4,29-5)30-6)47-49-70(76-22,58-64-82(34-10,35-11)36-12)51-53-72(78-24,60-66-84(40-16,41-17)42-18)54-52-71(77-23,59-65-83(37-13,38-14)39-15)50-48-69(75-21,46-44-67)57-63-81(31-7,32-8)33-9/h25-42H2,1-24H3 |
| InChIKey | KXGKYUNLMSQBOD-UHFFFAOYSA-N |
| XLogP | 14.64 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1238.17 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|