C32H30Si2 — CID 134977085
triethyl(20-triethylsilylicosa-1,3,5,7,9,11,13,15,17,19-decaynyl)silane (PubChem CID 134977085) has the molecular formula C32H30Si2 and a molecular weight of 470.76 g/mol. Its IUPAC name is triethyl(20-triethylsilylicosa-1,3,5,7,9,11,13,15,17,19-decaynyl)silane.
| Compound Name | triethyl(20-triethylsilylicosa-1,3,5,7,9,11,13,15,17,19-decaynyl)silane |
|---|---|
| PubChem CID | 134977085 |
| Molecular Formula | C32H30Si2 |
| Molecular Weight | 470.76 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | triethyl(20-triethylsilylicosa-1,3,5,7,9,11,13,15,17,19-decaynyl)silane |
| SMILES | CC[Si](C#CC#CC#CC#CC#CC#CC#CC#CC#CC#C[Si](CC)(CC)CC)(CC)CC |
| InChI | InChI=1S/C32H30Si2/c1-7-33(8-2,9-3)31-29-27-25-23-21-19-17-15-13-14-16-18-20-22-24-26-28-30-32-34(10-4,11-5)12-6/h7-12H2,1-6H3 |
| InChIKey | QUJALOLMFVNUSQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.76 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|