C16H28OSi2 — CID 86073787
dimethyl-prop-2-enyl-(5-triethylsilylpenta-2,4-diynoxy)silane (PubChem CID 86073787) has the molecular formula C16H28OSi2 and a molecular weight of 292.57 g/mol. Its IUPAC name is dimethyl-prop-2-enyl-(5-triethylsilylpenta-2,4-diynoxy)silane.
| Compound Name | dimethyl-prop-2-enyl-(5-triethylsilylpenta-2,4-diynoxy)silane |
|---|---|
| PubChem CID | 86073787 |
| Molecular Formula | C16H28OSi2 |
| Molecular Weight | 292.57 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | dimethyl-prop-2-enyl-(5-triethylsilylpenta-2,4-diynoxy)silane |
| SMILES | C=CC[Si](C)(C)OCC#CC#C[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H28OSi2/c1-7-15-18(5,6)17-14-12-11-13-16-19(8-2,9-3)10-4/h7H,1,8-10,14-15H2,2-6H3 |
| InChIKey | PSLBSUWQSKTVNL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|