C15H23NSi — CID 142712834
N,N-bis(prop-2-ynyl)-3-triethylsilylprop-2-yn-1-amine (PubChem CID 142712834) has the molecular formula C15H23NSi and a molecular weight of 245.44 g/mol. Its IUPAC name is N,N-bis(prop-2-ynyl)-3-triethylsilylprop-2-yn-1-amine.
| Compound Name | N,N-bis(prop-2-ynyl)-3-triethylsilylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 142712834 |
| Molecular Formula | C15H23NSi |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N,N-bis(prop-2-ynyl)-3-triethylsilylprop-2-yn-1-amine |
| SMILES | C#CCN(CC#C)CC#C[Si](CC)(CC)CC |
| InChI | InChI=1S/C15H23NSi/c1-6-12-16(13-7-2)14-11-15-17(8-3,9-4)10-5/h1-2H,8-10,12-14H2,3-5H3 |
| InChIKey | FUVJEJDVYLZIKL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|