C13H22N2O — CID 139342756
1,3-bis[ethyl(prop-2-ynyl)amino]propan-2-ol (PubChem CID 139342756) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1,3-bis[ethyl(prop-2-ynyl)amino]propan-2-ol.
| Compound Name | 1,3-bis[ethyl(prop-2-ynyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 139342756 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1,3-bis[ethyl(prop-2-ynyl)amino]propan-2-ol |
| SMILES | C#CCN(CC)CC(O)CN(CC)CC#C |
| InChI | InChI=1S/C13H22N2O/c1-5-9-14(7-3)11-13(16)12-15(8-4)10-6-2/h1-2,13,16H,7-12H2,3-4H3 |
| InChIKey | VWAVLKZRCWFPNS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|