C35H54O2Si3 — CID 102086375
triethyl-[3-ethynyl-3,6-dimethoxy-11-triethylsilyl-6-(2-triethylsilylethynyl)undeca-1,4,7,10-tetraynyl]silane (PubChem CID 102086375) has the molecular formula C35H54O2Si3 and a molecular weight of 591.07 g/mol. Its IUPAC name is triethyl-[3-ethynyl-3,6-dimethoxy-11-triethylsilyl-6-(2-triethylsilylethynyl)undeca-1,4,7,10-tetraynyl]silane.
| Compound Name | triethyl-[3-ethynyl-3,6-dimethoxy-11-triethylsilyl-6-(2-triethylsilylethynyl)undeca-1,4,7,10-tetraynyl]silane |
|---|---|
| PubChem CID | 102086375 |
| Molecular Formula | C35H54O2Si3 |
| Molecular Weight | 591.07 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | triethyl-[3-ethynyl-3,6-dimethoxy-11-triethylsilyl-6-(2-triethylsilylethynyl)undeca-1,4,7,10-tetraynyl]silane |
| SMILES | C#CC(C#CC(C#CCC#C[Si](CC)(CC)CC)(C#C[Si](CC)(CC)CC)OC)(C#C[Si](CC)(CC)CC)OC |
| InChI | InChI=1S/C35H54O2Si3/c1-13-34(36-11,29-32-39(17-5,18-6)19-7)27-28-35(37-12,30-33-40(20-8,21-9)22-10)26-24-23-25-31-38(14-2,15-3)16-4/h1H,14-23H2,2-12H3 |
| InChIKey | YZBIRBFJILIYED-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.07 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|