C66H96O6Si6 — CID 102086369
1,4,7,10,13,16-hexakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayne-1,4,7,10,13,16-hexol (PubChem CID 102086369) has the molecular formula C66H96O6Si6 and a molecular weight of 1154.00 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayne-1,4,7,10,13,16-hexol.
| Compound Name | 1,4,7,10,13,16-hexakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayne-1,4,7,10,13,16-hexol |
|---|---|
| PubChem CID | 102086369 |
| Molecular Formula | C66H96O6Si6 |
| Molecular Weight | 1154.00 g/mol |
| Exact Mass | 1152.58 |
| IUPAC Name | 1,4,7,10,13,16-hexakis(2-triethylsilylethynyl)cyclooctadeca-2,5,8,11,14,17-hexayne-1,4,7,10,13,16-hexol |
| SMILES | CC[Si](C#CC1(O)C#CC(O)(C#C[Si](CC)(CC)CC)C#CC(O)(C#C[Si](CC)(CC)CC)C#CC(O)(C#C[Si](CC)(CC)CC)C#CC(O)(C#C[Si](CC)(CC)CC)C#CC(O)(C#C[Si](CC)(CC)CC)C#C1)(CC)CC |
| InChI | InChI=1S/C66H96O6Si6/c1-19-73(20-2,21-3)55-49-61(67)37-39-62(68,50-56-74(22-4,23-5)24-6)41-43-64(70,52-58-76(28-10,29-11)30-12)45-47-66(72,54-60-78(34-16,35-17)36-18)48-46-65(71,53-59-77(31-13,32-14)33-15)44-42-63(69,40-38-61)51-57-75(25-7,26-8)27-9/h67-72H,19-36H2,1-18H3 |
| InChIKey | SDNGXUAZYFWYTD-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1154.00 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|