C28H44O2Si3 — CID 102086371
3-ethynyl-6-methoxy-1-triethylsilyl-6-(2-triethylsilylethynyl)-8-trimethylsilylocta-1,4,7-triyn-3-ol (PubChem CID 102086371) has the molecular formula C28H44O2Si3 and a molecular weight of 496.92 g/mol. Its IUPAC name is 3-ethynyl-6-methoxy-1-triethylsilyl-6-(2-triethylsilylethynyl)-8-trimethylsilylocta-1,4,7-triyn-3-ol.
| Compound Name | 3-ethynyl-6-methoxy-1-triethylsilyl-6-(2-triethylsilylethynyl)-8-trimethylsilylocta-1,4,7-triyn-3-ol |
|---|---|
| PubChem CID | 102086371 |
| Molecular Formula | C28H44O2Si3 |
| Molecular Weight | 496.92 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 3-ethynyl-6-methoxy-1-triethylsilyl-6-(2-triethylsilylethynyl)-8-trimethylsilylocta-1,4,7-triyn-3-ol |
| SMILES | C#CC(O)(C#CC(C#C[Si](C)(C)C)(C#C[Si](CC)(CC)CC)OC)C#C[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H44O2Si3/c1-12-27(29,21-25-32(13-2,14-3)15-4)19-20-28(30-8,22-24-31(9,10)11)23-26-33(16-5,17-6)18-7/h1,29H,13-18H2,2-11H3 |
| InChIKey | ARXDYQXFTCTQGN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.92 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|