C14H34O2Si2 — CID 582854
(2,5-dimethyl-5-trimethylsilyloxyhexan-2-yl)oxy-trimethylsilane (PubChem CID 582854) has the molecular formula C14H34O2Si2 and a molecular weight of 290.60 g/mol. Its IUPAC name is (2,5-dimethyl-5-trimethylsilyloxyhexan-2-yl)oxy-trimethylsilane.
| Compound Name | (2,5-dimethyl-5-trimethylsilyloxyhexan-2-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 582854 |
| Molecular Formula | C14H34O2Si2 |
| Molecular Weight | 290.60 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (2,5-dimethyl-5-trimethylsilyloxyhexan-2-yl)oxy-trimethylsilane |
| SMILES | CC(C)(CCC(C)(C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H34O2Si2/c1-13(2,15-17(5,6)7)11-12-14(3,4)16-18(8,9)10/h11-12H2,1-10H3 |
| InChIKey | SMEGNSBJHJCCKN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|