C10H22O2Si — CID 71332572
2,2,4,4,7,7-hexamethyl-1,3,2-dioxasilepane (PubChem CID 71332572) has the molecular formula C10H22O2Si and a molecular weight of 202.37 g/mol. Its IUPAC name is 2,2,4,4,7,7-hexamethyl-1,3,2-dioxasilepane.
| Compound Name | 2,2,4,4,7,7-hexamethyl-1,3,2-dioxasilepane |
|---|---|
| PubChem CID | 71332572 |
| Molecular Formula | C10H22O2Si |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2,2,4,4,7,7-hexamethyl-1,3,2-dioxasilepane |
| SMILES | CC1(C)CCC(C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C10H22O2Si/c1-9(2)7-8-10(3,4)12-13(5,6)11-9/h7-8H2,1-6H3 |
| InChIKey | AXNUAIUMIDWEBO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|