C20H46O4Si2 — CID 171490733
tert-butyl-[5-[tert-butyl(dimethyl)silyl]peroxy-2,5-dimethylhexan-2-yl]peroxy-dimethylsilane (PubChem CID 171490733) has the molecular formula C20H46O4Si2 and a molecular weight of 406.76 g/mol. Its IUPAC name is tert-butyl-[5-[tert-butyl(dimethyl)silyl]peroxy-2,5-dimethylhexan-2-yl]peroxy-dimethylsilane.
| Compound Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]peroxy-2,5-dimethylhexan-2-yl]peroxy-dimethylsilane |
|---|---|
| PubChem CID | 171490733 |
| Molecular Formula | C20H46O4Si2 |
| Molecular Weight | 406.76 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]peroxy-2,5-dimethylhexan-2-yl]peroxy-dimethylsilane |
| SMILES | CC(C)(CCC(C)(C)OO[Si](C)(C)C(C)(C)C)OO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H46O4Si2/c1-17(2,3)25(11,12)23-21-19(7,8)15-16-20(9,10)22-24-26(13,14)18(4,5)6/h15-16H2,1-14H3 |
| InChIKey | GIQJCTOPHIPKMG-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.76 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|