C20H42O2Si2 — CID 91696953
trimethyl-(2,4,7,9-tetramethyl-7-trimethylsilyloxydec-5-yn-4-yl)oxysilane (PubChem CID 91696953) has the molecular formula C20H42O2Si2 and a molecular weight of 370.73 g/mol. Its IUPAC name is trimethyl-(2,4,7,9-tetramethyl-7-trimethylsilyloxydec-5-yn-4-yl)oxysilane.
| Compound Name | trimethyl-(2,4,7,9-tetramethyl-7-trimethylsilyloxydec-5-yn-4-yl)oxysilane |
|---|---|
| PubChem CID | 91696953 |
| Molecular Formula | C20H42O2Si2 |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | trimethyl-(2,4,7,9-tetramethyl-7-trimethylsilyloxydec-5-yn-4-yl)oxysilane |
| SMILES | CC(C)CC(C)(C#CC(C)(CC(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H42O2Si2/c1-17(2)15-19(5,21-23(7,8)9)13-14-20(6,16-18(3)4)22-24(10,11)12/h17-18H,15-16H2,1-12H3 |
| InChIKey | KULKYKKVQOKKFD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|