C35H60O6Si2 — CID 176819363
[bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxysilyl]methyl-bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxysilane (PubChem CID 176819363) has the molecular formula C35H60O6Si2 and a molecular weight of 633.03 g/mol. Its IUPAC name is [bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxysilyl]methyl-bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxysilane.
| Compound Name | [bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxysilyl]methyl-bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxysilane |
|---|---|
| PubChem CID | 176819363 |
| Molecular Formula | C35H60O6Si2 |
| Molecular Weight | 633.03 g/mol |
| Exact Mass | 632.39 |
| IUPAC Name | [bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxysilyl]methyl-bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxysilane |
| SMILES | C#CC(C)(CC(C)C)O[Si](C[Si](OC)(OC(C)(C#C)CC(C)C)OC(C)(C#C)CC(C)C)(OC)OC(C)(C#C)CC(C)C |
| InChI | InChI=1S/C35H60O6Si2/c1-19-32(13,23-28(5)6)38-42(36-17,39-33(14,20-2)24-29(7)8)27-43(37-18,40-34(15,21-3)25-30(9)10)41-35(16,22-4)26-31(11)12/h1-4,28-31H,23-27H2,5-18H3 |
| InChIKey | CIQNDPVQCLDTBL-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.03 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|